cas: 890709-17-8 — see every product listed under this CAS number, including other names
tert-Butyl 4-(quinolin-2-yl)piperazine-1-carboxylate (CAS 890709-17-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11IFKK-1g |
| cas | 890709-17-8 |
| size | 1g |
| availability | 35.04g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2296.40 Pln | |
| Fluorochem | 1g | 3777.85 Pln |
| delivery time | 3 weeks |
|---|
Tert-butyl 4-quinolin-2-ylpiperazine-1-carboxylate (CAS 890709-17-8) is a chemical compound with the molecular formula C18H23N3O2 and a molecular weight of 313.4 g/mol. IUPAC name: tert-butyl 4-quinolin-2-ylpiperazine-1-carboxylate. InChIKey: MOGQKMUFSORICV-UHFFFAOYSA-N.
| Molecular formula | C18H23N3O2 |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | tert-butyl 4-quinolin-2-ylpiperazine-1-carboxylate |
| InChIKey | MOGQKMUFSORICV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)