cas: 1260639-98-2 — see every product listed under this CAS number, including other names
tert-Butyl 4-amino-3-methoxypiperidine-1-carboxylate, 98%, 98% (CAS 1260639-98-2) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110K2A-25mg |
| cas | 1260639-98-2 |
| size | 25mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 506.00 Pln | |
| Chemat | 50mg | 616.40 Pln | |
| Chemat | 100mg | 726.80 Pln | |
| Chemat | 250mg | 1125.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-amino-3-methoxypiperidine-1-carboxylate (CAS 1260639-98-2) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl 4-amino-3-methoxypiperidine-1-carboxylate. InChIKey: QNGHCFVWYKWWMU-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl 4-amino-3-methoxypiperidine-1-carboxylate |
| InChIKey | QNGHCFVWYKWWMU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)OC)N |
Computed by PubChem (NCBI)