cas: 847139-23-5 — see every product listed under this CAS number, including other names
tert-Butyl 4-amino-3-methyl-1H-pyrazole-1-carboxylate, 95%, 95% (CAS 847139-23-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G0C0-10g |
| cas | 847139-23-5 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 3160.40 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 693.20 Pln | |
| Chemat | 5g | 1998.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-amino-3-methylpyrazole-1-carboxylate (CAS 847139-23-5) is a chemical compound with the molecular formula C9H15N3O2 and a molecular weight of 197.23 g/mol. IUPAC name: tert-butyl 4-amino-3-methylpyrazole-1-carboxylate. InChIKey: AZEOFHCJPAQKHH-UHFFFAOYSA-N.
| Molecular formula | C9H15N3O2 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | tert-butyl 4-amino-3-methylpyrazole-1-carboxylate |
| InChIKey | AZEOFHCJPAQKHH-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)