cas: 1053656-57-7 — see every product listed under this CAS number, including other names
tert-Butyl 4-chloro-5,6-dihydropyrido[3,4-d]pyrimidine-7(8H)-carboxylate, 95%, 95% (CAS 1053656-57-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149ZQ-100mg |
| cas | 1053656-57-7 |
| size | 100mg |
| availability | 175g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 904.40 Pln | |
| Chemat | 25g | 4034.00 Pln | |
| Chemat | 10g | 1653.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-chloro-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate (CAS 1053656-57-7) is a chemical compound with the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. IUPAC name: tert-butyl 4-chloro-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate. InChIKey: XYHXUYOSXZHUSZ-UHFFFAOYSA-N.
| Molecular formula | C12H16ClN3O2 |
|---|---|
| Molecular weight | 269.73 g/mol |
| IUPAC name | tert-butyl 4-chloro-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
| InChIKey | XYHXUYOSXZHUSZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)N=CN=C2Cl |
Computed by PubChem (NCBI)