tert-Butyl 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-1-carboxylate, 95%
cas: 2291372-28-4 — see every product listed under this CAS number, including other names
tert-Butyl 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-1-carboxylate, 95% (CAS 2291372-28-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2261727-250mg |
| cas | 2291372-28-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 548.38 Pln | |
| Ambeed | 5g | 1788.81 Pln | |
| Ambeed | 10g | 3168.31 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 530.00 Pln | |
| Chemat | 5g | 1691.60 Pln | |
| Chemat | 10g | 2992.40 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 536.50 Pln | |
| BLDpharm | 5g | 1752.74 Pln | |
| BLDpharm | 10g | 3113.37 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (CAS 2291372-28-4) is a chemical compound with the molecular formula C19H25BFNO4 and a molecular weight of 361.2 g/mol. IUPAC name: tert-butyl 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate. InChIKey: VRVVFINISVJQDN-UHFFFAOYSA-N.
| Molecular formula | C19H25BFNO4 |
|---|---|
| Molecular weight | 361.2 g/mol |
| IUPAC name | tert-butyl 4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| InChIKey | VRVVFINISVJQDN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N2C(=O)OC(C)(C)C)C=CC=C3F |
Computed by PubChem (NCBI)