tert-Butyl 4-fluoro-2-oxospiro[indoline-3,4'-piperidine]-1'-carboxylate, 95%
cas: 2197055-58-4 — see every product listed under this CAS number, including other names
tert-Butyl 4-fluoro-2-oxospiro[indoline-3,4'-piperidine]-1'-carboxylate, 95% (CAS 2197055-58-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 25mg, 50mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A799487-100mg |
| cas | 2197055-58-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 420.44 Pln | |
| Ambeed | 250mg | 759.75 Pln | |
| Ambeed | 1g | 2767.81 Pln | |
| Chemat | 25mg | 146.00 Pln | |
| Chemat | 50mg | 208.40 Pln | |
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 741.20 Pln | |
| Chemat | 1g | 2728.40 Pln | |
| BLDpharm | 25mg | 303.25 Pln | |
| BLDpharm | 50mg | 353.23 Pln | |
| BLDpharm | 100mg | 414.32 Pln | |
| BLDpharm | 250mg | 814.18 Pln | |
| BLDpharm | 1g | 2980.09 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 4-fluoro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate (CAS 2197055-58-4) is a chemical compound with the molecular formula C17H21FN2O3 and a molecular weight of 320.36 g/mol. IUPAC name: tert-butyl 4-fluoro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate. InChIKey: VMYSRVVQZPRBLN-UHFFFAOYSA-N.
| Molecular formula | C17H21FN2O3 |
|---|---|
| Molecular weight | 320.36 g/mol |
| IUPAC name | tert-butyl 4-fluoro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate |
| InChIKey | VMYSRVVQZPRBLN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)C3=C(C=CC=C3F)NC2=O |
Computed by PubChem (NCBI)
Synonyms:
tert-Butyl 4-fluoro-2-oxospiro[indoline-3,4'-piperidine]-1'-carboxylate, tert-butyl 4-fluoro-2-oxospiro[1H-indole-3,4'-piperidine]-1'-carboxylate, 4'-piperidine]-1'-carboxylate, tert-Butyl 4-?uoro-2-oxospiro[indoline-3,, 1''-Boc-4-fluoro-2-oxospiro[indoline-3,4''-piperidine], tert-butyl 4-fluoro-2-oxo-spiro[indoline-3,4'-piperidine]-1'-carboxylate, tert-Butyl 4-fluoro-2-oxospiro[indoline-3,4''-piperidine]-1''-carboxylate, tert-Butyl4-fluoro-2-oxospiro[indoline-3,4''-piperidine]-1''-carboxylate