tert-Butyl 4-hydroxy-2-(trifluoromethyl)piperidine-1-carboxylate, 95%
cas: 1785759-35-4 — see every product listed under this CAS number, including other names
tert-Butyl 4-hydroxy-2-(trifluoromethyl)piperidine-1-carboxylate, 95% (CAS 1785759-35-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg, 25mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A812842-100mg |
| cas | 1785759-35-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 726.38 Pln | |
| Ambeed | 250mg | 1271.50 Pln | |
| Ambeed | 1g | 3485.38 Pln | |
| Ambeed | 5g | 13191.94 Pln | |
| BLDpharm | 50mg | 575.38 Pln | |
| BLDpharm | 100mg | 775.31 Pln | |
| BLDpharm | 250mg | 1380.65 Pln | |
| BLDpharm | 1g | 3752.04 Pln | |
| BLDpharm | 5g | 12971.01 Pln | |
| Chemat | 25mg | 338.00 Pln | |
| Chemat | 50mg | 434.00 Pln | |
| Chemat | 100mg | 654.80 Pln | |
| Chemat | 250mg | 1048.40 Pln | |
| Chemat | 1g | 2728.40 Pln | |
| Chemat | 5g | 12990.80 Pln | |
| Fluorochem | 1g | 3580.01 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 4-hydroxy-2-(trifluoromethyl)piperidine-1-carboxylate (CAS 1785759-35-4) is a chemical compound with the molecular formula C11H18F3NO3 and a molecular weight of 269.26 g/mol. IUPAC name: tert-butyl 4-hydroxy-2-(trifluoromethyl)piperidine-1-carboxylate. InChIKey: JNYRUQBINDHTFN-UHFFFAOYSA-N.
| Molecular formula | C11H18F3NO3 |
|---|---|
| Molecular weight | 269.26 g/mol |
| IUPAC name | tert-butyl 4-hydroxy-2-(trifluoromethyl)piperidine-1-carboxylate |
| InChIKey | JNYRUQBINDHTFN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1C(F)(F)F)O |
Computed by PubChem (NCBI)