cas: 1821237-04-0 — see every product listed under this CAS number, including other names
tert-Butyl 4-hydroxyoctahydro-1H-indole-1-carboxylate, 95+% (CAS 1821237-04-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A590274-5g |
| cas | 1821237-04-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 21969.64 Pln | |
| AmBeed | 1g | 10075.87 Pln | |
| AmBeed | 100mg | 5141.29 Pln | |
| AmBeed | 250mg | 8337.70 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 4-hydroxy-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate (CAS 1821237-04-0) is a chemical compound with the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. IUPAC name: tert-butyl 4-hydroxy-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate. InChIKey: MRMYRYLVMIZVQM-UHFFFAOYSA-N.
| Molecular formula | C13H23NO3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | tert-butyl 4-hydroxy-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
| InChIKey | MRMYRYLVMIZVQM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2C1CCCC2O |
Computed by PubChem (NCBI)