cas: 123387-50-8 — see every product listed under this CAS number, including other names
tert-Butyl 4-methylpiperidine-1-carboxylate 97% (CAS 123387-50-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A300732-250mg |
| cas | 123387-50-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 398.19 Pln | |
| Ambeed | 25g | 1716.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A300732 |
Tert-butyl 4-methylpiperidine-1-carboxylate (CAS 123387-50-8) is a chemical compound with the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. IUPAC name: tert-butyl 4-methylpiperidine-1-carboxylate. InChIKey: OXSSNJRGXRJNPX-UHFFFAOYSA-N.
| Molecular formula | C11H21NO2 |
|---|---|
| Molecular weight | 199.29 g/mol |
| IUPAC name | tert-butyl 4-methylpiperidine-1-carboxylate |
| InChIKey | OXSSNJRGXRJNPX-UHFFFAOYSA-N |
| SMILES | CC1CCN(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)