cas: 733757-79-4 — see every product listed under this CAS number, including other names
tert-Butyl 4-oxo-3-(trifluoroacetyl)piperidine-1-carboxylate, 97%, 97% (CAS 733757-79-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116EJI-100mg |
| cas | 733757-79-4 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 554.00 Pln | |
| Chemat | 5g | 1902.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-oxo-3-(2,2,2-trifluoroacetyl)piperidine-1-carboxylate (CAS 733757-79-4) is a chemical compound with the molecular formula C12H16F3NO4 and a molecular weight of 295.25 g/mol. IUPAC name: tert-butyl 4-oxo-3-(2,2,2-trifluoroacetyl)piperidine-1-carboxylate. InChIKey: SLHNDMPEIUPCNG-UHFFFAOYSA-N.
| Molecular formula | C12H16F3NO4 |
|---|---|
| Molecular weight | 295.25 g/mol |
| IUPAC name | tert-butyl 4-oxo-3-(2,2,2-trifluoroacetyl)piperidine-1-carboxylate |
| InChIKey | SLHNDMPEIUPCNG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)