cas: 1256359-17-7 — see every product listed under this CAS number, including other names
tert-Butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-1-carboxylate 96% (CAS 1256359-17-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A331227-250mg |
| cas | 1256359-17-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A331227 |
Tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate (CAS 1256359-17-7) is a chemical compound with the molecular formula C14H23BN2O4 and a molecular weight of 294.16 g/mol. IUPAC name: tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate. InChIKey: HWUUHAAZWMTBNW-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O4 |
|---|---|
| Molecular weight | 294.16 g/mol |
| IUPAC name | tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate |
| InChIKey | HWUUHAAZWMTBNW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=NN2C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)