cas: 928653-81-0 — see every product listed under this CAS number, including other names
tert-Butyl 5-bromo-3-iodo-1H-pyrrolo[2,3-b]pyridine-1-carboxylate, 95% (CAS 928653-81-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F622291-50MG |
| cas | 928653-81-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 763.29 Pln | |
| Fluorochem | 100mg | 914.28 Pln | |
| Fluorochem | 250mg | 2007.64 Pln | |
| Fluorochem | 1g | 6136.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 5-bromo-3-iodopyrrolo[2,3-b]pyridine-1-carboxylate (CAS 928653-81-0) is a chemical compound with the molecular formula C12H12BrIN2O2 and a molecular weight of 423.04 g/mol. IUPAC name: tert-butyl 5-bromo-3-iodopyrrolo[2,3-b]pyridine-1-carboxylate. InChIKey: NMRYZNNFHQJPMH-UHFFFAOYSA-N.
| Molecular formula | C12H12BrIN2O2 |
|---|---|
| Molecular weight | 423.04 g/mol |
| IUPAC name | tert-butyl 5-bromo-3-iodopyrrolo[2,3-b]pyridine-1-carboxylate |
| InChIKey | NMRYZNNFHQJPMH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1N=CC(=C2)Br)I |
Computed by PubChem (NCBI)