cas: 2304635-21-8 — see every product listed under this CAS number, including other names
tert-Butyl 5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydropyridine-1(2H)-carboxylate 98% (CAS 2304635-21-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A841517-50mg |
| cas | 2304635-21-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 459.38 Pln | |
| Ambeed | 100mg | 726.38 Pln | |
| Ambeed | 250mg | 1510.69 Pln | |
| Ambeed | 1g | 4236.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A841517 |
Tert-butyl 5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 2304635-21-8) is a chemical compound with the molecular formula C17H30BNO4 and a molecular weight of 323.2 g/mol. IUPAC name: tert-butyl 5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: NPVOYNRFIUWOJO-UHFFFAOYSA-N.
| Molecular formula | C17H30BNO4 |
|---|---|
| Molecular weight | 323.2 g/mol |
| IUPAC name | tert-butyl 5-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| InChIKey | NPVOYNRFIUWOJO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(CN(CC2)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)