cas: 2411223-34-0 — see every product listed under this CAS number, including other names
tert-Butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-azaspiro[3.4]oct-6-ene-2-carboxylate, 95% (CAS 2411223-34-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F781772-100MG |
| cas | 2411223-34-0 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1664.02 Pln | |
| Fluorochem | 250mg | 2611.60 Pln | |
| Fluorochem | 500mg | 4694.20 Pln | |
| Fluorochem | 1g | 6370.69 Pln | |
| Fluorochem | 5g | 21740.28 Pln | |
| Ambeed | 100mg | 2172.62 Pln | |
| Ambeed | 250mg | 3891.44 Pln | |
| Chemat | 100mg | 1360.40 Pln | |
| Chemat | 250mg | 2426.00 Pln | |
| Chemat | 1g | 4667.60 Pln | |
| Chemat | 5g | 16187.60 Pln | |
| BLDpharm | 100mg | 2346.98 Pln | |
| BLDpharm | 250mg | 4201.88 Pln | |
| BLDpharm | 1g | 8117.17 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Tert-butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-azaspiro[3.4]oct-6-ene-2-carboxylate (CAS 2411223-34-0) is a chemical compound with the molecular formula C18H30BNO4 and a molecular weight of 335.2 g/mol. IUPAC name: tert-butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-azaspiro[3.4]oct-6-ene-2-carboxylate. InChIKey: GWAWVEFDTDAGDZ-UHFFFAOYSA-N.
| Molecular formula | C18H30BNO4 |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | tert-butyl 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-azaspiro[3.4]oct-6-ene-2-carboxylate |
| InChIKey | GWAWVEFDTDAGDZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCC3(C2)CN(C3)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)