cas: 893566-74-0 — see every product listed under this CAS number, including other names
tert-Butyl 6-bromo-3,4-dihydroisoquinoline-2(1H)-carboxylate, 95% (CAS 893566-74-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F221590-1G |
| cas | 893566-74-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 263.47 Pln | |
| Fluorochem | 10g | 471.73 Pln | |
| Fluorochem | 25g | 1013.20 Pln | |
| Fluorochem | 100g | 3595.63 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 6-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate (CAS 893566-74-0) is a chemical compound with the molecular formula C14H18BrNO2 and a molecular weight of 312.20 g/mol. IUPAC name: tert-butyl 6-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate. InChIKey: SZIPGDGOBMFCEH-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO2 |
|---|---|
| Molecular weight | 312.20 g/mol |
| IUPAC name | tert-butyl 6-bromo-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| InChIKey | SZIPGDGOBMFCEH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=CC(=C2)Br |
Computed by PubChem (NCBI)