cas: 1218790-23-8 — see every product listed under this CAS number, including other names
tert-Butyl 6-cyano-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-1-carboxylate 97% (CAS 1218790-23-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A213688-100mg |
| cas | 1218790-23-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1744.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A213688 |
Tert-butyl 6-cyano-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate (CAS 1218790-23-8) is a chemical compound with the molecular formula C20H25BN2O4 and a molecular weight of 368.2 g/mol. IUPAC name: tert-butyl 6-cyano-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate. InChIKey: YDIXOIZBVRXBQH-UHFFFAOYSA-N.
| Molecular formula | C20H25BN2O4 |
|---|---|
| Molecular weight | 368.2 g/mol |
| IUPAC name | tert-butyl 6-cyano-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate |
| InChIKey | YDIXOIZBVRXBQH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(C3=C2C=CC(=C3)C#N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)