cas: 1214932-35-0 — see every product listed under this CAS number, including other names
tert-Butyl 6-iodo-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-1-carboxylate, 95%, 95% (CAS 1214932-35-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HG0K-50mg |
| cas | 1214932-35-0 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 650.00 Pln | |
| Chemat | 100mg | 1058.00 Pln | |
| Chemat | 250mg | 1758.80 Pln | |
| Chemat | 1g | 4638.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 6-iodo-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate (CAS 1214932-35-0) is a chemical compound with the molecular formula C12H15IN2O3 and a molecular weight of 362.16 g/mol. IUPAC name: tert-butyl 6-iodo-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate. InChIKey: WUIDSMOCKFSZBA-UHFFFAOYSA-N.
| Molecular formula | C12H15IN2O3 |
|---|---|
| Molecular weight | 362.16 g/mol |
| IUPAC name | tert-butyl 6-iodo-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate |
| InChIKey | WUIDSMOCKFSZBA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2=C1C=CC(=N2)I |
Computed by PubChem (NCBI)