cas: 2133298-72-1 — see every product listed under this CAS number, including other names
tert-Butyl 7-(2-hydroxy-4-oxo-4H-pyrido[1,2-a]pyrimidin-7-yl)-4,7-diazaspiro[2.5]octane-4-carboxylate, 95% (CAS 2133298-72-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1593065-250mg |
| cas | 2133298-72-1 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 876.56 Pln | |
| Ambeed | 1g | 2239.38 Pln | |
| Ambeed | 5g | 6572.56 Pln | |
| BLDpharm | 100mg | 575.38 Pln | |
| BLDpharm | 250mg | 936.36 Pln | |
| BLDpharm | 1g | 2408.07 Pln | |
| BLDpharm | 5g | 7084.20 Pln | |
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 645.20 Pln | |
| Chemat | 1g | 1638.80 Pln | |
| Chemat | 5g | 4787.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 7-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-7-yl)-4,7-diazaspiro[2.5]octane-4-carboxylate (CAS 2133298-72-1) is a chemical compound with the molecular formula C19H24N4O4 and a molecular weight of 372.4 g/mol. IUPAC name: tert-butyl 7-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-7-yl)-4,7-diazaspiro[2.5]octane-4-carboxylate. InChIKey: LOMKIDUODAAOHI-UHFFFAOYSA-N.
| Molecular formula | C19H24N4O4 |
|---|---|
| Molecular weight | 372.4 g/mol |
| IUPAC name | tert-butyl 7-(2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-7-yl)-4,7-diazaspiro[2.5]octane-4-carboxylate |
| InChIKey | LOMKIDUODAAOHI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC12CC2)C3=CN4C(=NC(=CC4=O)O)C=C3 |
Computed by PubChem (NCBI)