cas: 875551-59-0 — see every product listed under this CAS number, including other names
tert-Butyl N-[(2S)-morpholin-2-ylmethyl]carbamate 95% (CAS 875551-59-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A406722-100mg |
| cas | 875551-59-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 681.88 Pln | |
| Ambeed | 5g | 2356.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A406722 |
Tert-butyl N-[[(2S)-morpholin-2-yl]methyl]carbamate (CAS 875551-59-0) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl N-[[(2S)-morpholin-2-yl]methyl]carbamate. InChIKey: IYHJNCQAADULQE-QMMMGPOBSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl N-[[(2S)-morpholin-2-yl]methyl]carbamate |
| InChIKey | IYHJNCQAADULQE-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1CNCCO1 |
Computed by PubChem (NCBI)