cas: 160502-09-0 — see every product listed under this CAS number, including other names
tert-Butyl N-[2-(trifluoroacetamido)ethyl]carbamate, 97%, 97% (CAS 160502-09-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112RZH-100mg |
| cas | 160502-09-0 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 500mg | 323.60 Pln | |
| Chemat | 1g | 414.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate (CAS 160502-09-0) is a chemical compound with the molecular formula C9H15F3N2O3 and a molecular weight of 256.22 g/mol. IUPAC name: tert-butyl N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate. InChIKey: LRIIKOSSPGMOTQ-UHFFFAOYSA-N.
| Molecular formula | C9H15F3N2O3 |
|---|---|
| Molecular weight | 256.22 g/mol |
| IUPAC name | tert-butyl N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]carbamate |
| InChIKey | LRIIKOSSPGMOTQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)C(F)(F)F |
Computed by PubChem (NCBI)