cas: 138026-97-8 — see every product listed under this CAS number, including other names
tert-Butyl rac-(3S,4R)-3-amino-4-hydroxy-1-pyrrolidinecarboxylate hydrochloride, 97% (CAS 138026-97-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F476770-100MG |
| cas | 138026-97-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 747.67 Pln | |
| Fluorochem | 250mg | 971.55 Pln | |
| Fluorochem | 500mg | 1559.89 Pln | |
| Fluorochem | 1g | 2288.80 Pln | |
| Fluorochem | 5g | 6724.73 Pln | |
| Fluorochem | 10g | 10161.02 Pln | |
| Fluorochem | 25g | 20251.22 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3S,4R)-3-amino-4-hydroxypyrrolidine-1-carboxylate (CAS 138026-97-8) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl (3S,4R)-3-amino-4-hydroxypyrrolidine-1-carboxylate. InChIKey: MOZOQDNRVPHFOO-NKWVEPMBSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3-amino-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | MOZOQDNRVPHFOO-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@@H](C1)O)N |
Computed by PubChem (NCBI)