CAS 148017-28-1 appears in our catalog under these names: tert-Butyl Sulfamoylcarbamate, >98.0%(N)(T), tert-Butyl sulfamoylcarbamate, 97%, 97%, tert-Butyl Aminosulfonylcarbamate, 97%. Offered by: TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
Tert-butyl N-sulfamoylcarbamate (CAS 148017-28-1) is a chemical compound with the molecular formula C5H12N2O4S and a molecular weight of 196.23 g/mol. IUPAC name: tert-butyl N-sulfamoylcarbamate. InChIKey: WPCQASPMIALUEE-UHFFFAOYSA-N.
| Molecular formula | C5H12N2O4S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | tert-butyl N-sulfamoylcarbamate |
| InChIKey | WPCQASPMIALUEE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)N |
Computed by PubChem (NCBI)