cas: 916587-44-5 — see every product listed under this CAS number, including other names
tert-Butyl-N-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate, 95% (CAS 916587-44-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F010777-1G |
| cas | 916587-44-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 747.67 Pln | |
| Fluorochem | 25g | 2346.07 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate (CAS 916587-44-5) is a chemical compound with the molecular formula C18H28BNO4 and a molecular weight of 333.2 g/mol. IUPAC name: tert-butyl N-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate. InChIKey: MWNMXMKLILKYOS-UHFFFAOYSA-N.
| Molecular formula | C18H28BNO4 |
|---|---|
| Molecular weight | 333.2 g/mol |
| IUPAC name | tert-butyl N-methyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbamate |
| InChIKey | MWNMXMKLILKYOS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)