cas: 132564-22-8 — see every product listed under this CAS number, including other names
tert-Butyl6-oxo-1-azaspiro[4.4]nonane-1-carboxylate, 97% (CAS 132564-22-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691361-100MG |
| cas | 132564-22-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1559.89 Pln | |
| Fluorochem | 250mg | 2439.78 Pln | |
| Fluorochem | 500mg | 4012.15 Pln | |
| Fluorochem | 1g | 5980.20 Pln | |
| Fluorochem | 5g | 17793.75 Pln | |
| Fluorochem | 10g | 29612.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 9-oxo-1-azaspiro[4.4]nonane-1-carboxylate (CAS 132564-22-8) is a chemical compound with the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. IUPAC name: tert-butyl 9-oxo-1-azaspiro[4.4]nonane-1-carboxylate. InChIKey: BHTLCXQCKBZQTH-UHFFFAOYSA-N.
| Molecular formula | C13H21NO3 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | tert-butyl 9-oxo-1-azaspiro[4.4]nonane-1-carboxylate |
| InChIKey | BHTLCXQCKBZQTH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC12CCCC2=O |
Computed by PubChem (NCBI)