tert-Butyldimethyl((2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)allyl)oxy)silane, 97%
cas: 350498-98-5 — see every product listed under this CAS number, including other names
tert-Butyldimethyl((2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)allyl)oxy)silane, 97% (CAS 350498-98-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg, 500mg, 50g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A793521-250mg |
| cas | 350498-98-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 531.69 Pln | |
| Ambeed | 1g | 915.50 Pln | |
| Ambeed | 5g | 1911.19 Pln | |
| Ambeed | 10g | 2834.56 Pln | |
| Ambeed | 25g | 5599.12 Pln | |
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 500mg | 405.20 Pln | |
| Chemat | 1g | 611.60 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1302.80 Pln | |
| Chemat | 25g | 2128.40 Pln | |
| Chemat | 50g | 3165.20 Pln | |
| Chemat | 100g | 3746.00 Pln | |
| Chemat | 250g | 7365.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl-dimethyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoxy]silane (CAS 350498-98-5) is a chemical compound with the molecular formula C15H31BO3Si and a molecular weight of 298.3 g/mol. IUPAC name: tert-butyl-dimethyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoxy]silane. InChIKey: BDMALLJGDNDETC-UHFFFAOYSA-N.
| Molecular formula | C15H31BO3Si |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | tert-butyl-dimethyl-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoxy]silane |
| InChIKey | BDMALLJGDNDETC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)CO[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)