tert-Butyldimethyl((4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)methoxy)silane, 95+%
cas: 2828439-46-7 — see every product listed under this CAS number, including other names
tert-Butyldimethyl((4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl)methoxy)silane, 95+% (CAS 2828439-46-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1531391-250mg |
| cas | 2828439-46-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 453.81 Pln | |
| Ambeed | 5g | 1416.12 Pln | |
| Ambeed | 25g | 4764.75 Pln | |
| Chemat | 100mg | 155.60 Pln | |
| Chemat | 250mg | 218.00 Pln | |
| Chemat | 1g | 477.20 Pln | |
| BLDpharm | 100mg | 153.30 Pln | |
| BLDpharm | 250mg | 214.39 Pln | |
| BLDpharm | 1g | 447.64 Pln | |
| BLDpharm | 5g | 1380.65 Pln | |
| BLDpharm | 25g | 4668.38 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl-dimethyl-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methoxy]silane (CAS 2828439-46-7) is a chemical compound with the molecular formula C17H31BO3SSi and a molecular weight of 354.4 g/mol. IUPAC name: tert-butyl-dimethyl-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methoxy]silane. InChIKey: JNBRBACLOBXQCJ-UHFFFAOYSA-N.
| Molecular formula | C17H31BO3SSi |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | tert-butyl-dimethyl-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]methoxy]silane |
| InChIKey | JNBRBACLOBXQCJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSC(=C2)CO[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)