CAS 33729-92-9 appears in our catalog under these names: tert–Butyldiphenylsilane, tert-Butyldiphenylsilane, >98.0%(GC), tert-Butyldiphenylsilane, 98%, 98%, t-Butyl diphenyl silane, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 50g, 100g, 200g, 300g.
Tert-butyl(diphenyl)silane (CAS 33729-92-9) is a chemical compound with the molecular formula C16H20Si and a molecular weight of 240.41 g/mol. IUPAC name: tert-butyl(diphenyl)silane. InChIKey: VTORJPDWMOIOIQ-UHFFFAOYSA-N.
| Molecular formula | C16H20Si |
|---|---|
| Molecular weight | 240.41 g/mol |
| IUPAC name | tert-butyl(diphenyl)silane |
| InChIKey | VTORJPDWMOIOIQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[SiH](C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)