tert-Butyldiphenylsilane, 98%
cas: 33729-92-9 — see every product listed under this CAS number, including other names
tert-Butyldiphenylsilane, 98% (CAS 33729-92-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 15g, 25g, 50g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A272543-250mg |
| cas | 33729-92-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 553.94 Pln | |
| Ambeed | 10g | 843.19 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 15g | 136.40 Pln | |
| Chemat | 25g | 170.00 Pln | |
| Chemat | 50g | 266.00 Pln | |
| Chemat | 100g | 467.60 Pln | |
| Chemat | 200g | 832.40 Pln | |
| Chemat | 300g | 1206.80 Pln | |
| Chemat | 400g | 1571.60 Pln | |
| BLDpharm | 250mg | 131.09 Pln | |
| BLDpharm | 1g | 219.95 Pln | |
| BLDpharm | 5g | 586.48 Pln | |
| BLDpharm | 10g | 903.04 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl(diphenyl)silane (CAS 33729-92-9) is a chemical compound with the molecular formula C16H20Si and a molecular weight of 240.41 g/mol. IUPAC name: tert-butyl(diphenyl)silane. InChIKey: VTORJPDWMOIOIQ-UHFFFAOYSA-N.
| Molecular formula | C16H20Si |
|---|---|
| Molecular weight | 240.41 g/mol |
| IUPAC name | tert-butyl(diphenyl)silane |
| InChIKey | VTORJPDWMOIOIQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[SiH](C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)