cas: 161118-67-8 — see every product listed under this CAS number, including other names
tert-Butylimino-tri(pyrrolidino)phosphorane, 98% (CAS 161118-67-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F890221-250MG |
| cas | 161118-67-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 482.14 Pln | |
| Fluorochem | 5g | 1539.06 Pln | |
| Fluorochem | 10g | 2783.41 Pln | |
| Fluorochem | 25g | 4793.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butylimino(tripyrrolidin-1-yl)-lambda5-phosphane (CAS 161118-67-8) is a chemical compound with the molecular formula C16H33N4P and a molecular weight of 312.43 g/mol. IUPAC name: tert-butylimino(tripyrrolidin-1-yl)-lambda5-phosphane. InChIKey: PVNUIRUAPVSSOK-UHFFFAOYSA-N.
| Molecular formula | C16H33N4P |
|---|---|
| Molecular weight | 312.43 g/mol |
| IUPAC name | tert-butylimino(tripyrrolidin-1-yl)-lambda5-phosphane |
| InChIKey | PVNUIRUAPVSSOK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N=P(N1CCCC1)(N2CCCC2)N3CCCC3 |
Computed by PubChem (NCBI)