CAS 161118-69-0 appears in our catalog under these names: Phosphazene base P, PHOSPHAZENE BASE P1-T-OCT, >=97.0%. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 1ml, 5ML.
N-[bis(dimethylamino)-(2,4,4-trimethylpentan-2-ylimino)-lambda5-phosphanyl]-N-methylmethanamine (CAS 161118-69-0) is a chemical compound with the molecular formula C14H35N4P and a molecular weight of 290.43 g/mol. IUPAC name: N-[bis(dimethylamino)-(2,4,4-trimethylpentan-2-ylimino)-lambda5-phosphanyl]-N-methylmethanamine. InChIKey: DSCJCKAURXOQPX-UHFFFAOYSA-N.
| Molecular formula | C14H35N4P |
|---|---|
| Molecular weight | 290.43 g/mol |
| IUPAC name | N-[bis(dimethylamino)-(2,4,4-trimethylpentan-2-ylimino)-lambda5-phosphanyl]-N-methylmethanamine |
| InChIKey | DSCJCKAURXOQPX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)N=P(N(C)C)(N(C)C)N(C)C |
Computed by PubChem (NCBI)