cas: 1034912-28-1 — see every product listed under this CAS number, including other names
tert-butyl (1R,4S)-2-azabicyclo[2.2.1]heptane-2-carboxylate, 97% (CAS 1034912-28-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F874096-50MG |
| cas | 1034912-28-1 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 174.96 Pln | |
| Fluorochem | 100mg | 237.43 Pln | |
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 997.58 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (1R,4S)-2-azabicyclo[2.2.1]heptane-2-carboxylate (CAS 1034912-28-1) is a chemical compound with the molecular formula C11H19NO2 and a molecular weight of 197.27 g/mol. IUPAC name: tert-butyl (1R,4S)-2-azabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: AJYDSJWVRJUFMI-DTWKUNHWSA-N.
| Molecular formula | C11H19NO2 |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | tert-butyl (1R,4S)-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | AJYDSJWVRJUFMI-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC[C@@H]1C2 |
Computed by PubChem (NCBI)