cas: 1161932-04-2 — see every product listed under this CAS number, including other names
tert-butyl (3S,4S)-4-amino-3-hydroxypiperidine-1-carboxylate, 98% (CAS 1161932-04-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F545084-100MG |
| cas | 1161932-04-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 500mg | 565.44 Pln | |
| Fluorochem | 1g | 1096.51 Pln | |
| Fluorochem | 5g | 3501.91 Pln | |
| Fluorochem | 10g | 6474.82 Pln | |
| Fluorochem | 25g | 13383.85 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3S,4S)-4-amino-3-hydroxypiperidine-1-carboxylate (CAS 1161932-04-2) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (3S,4S)-4-amino-3-hydroxypiperidine-1-carboxylate. InChIKey: KREUZCYJWPQPJX-YUMQZZPRSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (3S,4S)-4-amino-3-hydroxypiperidine-1-carboxylate |
| InChIKey | KREUZCYJWPQPJX-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H]([C@H](C1)O)N |
Computed by PubChem (NCBI)