cas: 1414475-01-6 — see every product listed under this CAS number, including other names
tert-butyl 2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)ethylcarbamate, 98%, 98% (CAS 1414475-01-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112GE0-100mg |
| cas | 1414475-01-6 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 467.60 Pln | |
| Chemat | 250mg | 770.00 Pln | |
| Chemat | 500mg | 1350.80 Pln | |
| Chemat | 1g | 1917.20 Pln | |
| Chemat | 5g | 5267.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]carbamate (CAS 1414475-01-6) is a chemical compound with the molecular formula C16H28BN3O4 and a molecular weight of 337.2 g/mol. IUPAC name: tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]carbamate. InChIKey: REFRJKFVMSRUEM-UHFFFAOYSA-N.
| Molecular formula | C16H28BN3O4 |
|---|---|
| Molecular weight | 337.2 g/mol |
| IUPAC name | tert-butyl N-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]ethyl]carbamate |
| InChIKey | REFRJKFVMSRUEM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)CCNC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)