cas: 2090743-38-5 — see every product listed under this CAS number, including other names
tert-butyl 3-(fluoromethyl)-3-hydroxyazetidine-1-carboxylate, 97% (CAS 2090743-38-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g, 10g, 25g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A232534-5g |
| cas | 2090743-38-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 20465.83 Pln | |
| Fluorochem | 100mg | 872.63 Pln | |
| Fluorochem | 250mg | 1185.02 Pln | |
| Fluorochem | 500mg | 1960.79 Pln | |
| Fluorochem | 1g | 3215.55 Pln | |
| Fluorochem | 5g | 9234.27 Pln | |
| Chemat | 100mg | 525.20 Pln | |
| Chemat | 250mg | 712.40 Pln | |
| Chemat | 500mg | 1178.00 Pln | |
| Chemat | 1g | 1917.20 Pln | |
| Chemat | 5g | 5632.40 Pln | |
| Chemat | 10g | 9347.60 Pln | |
| Chemat | 25g | 18630.80 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 3-(fluoromethyl)-3-hydroxyazetidine-1-carboxylate (CAS 2090743-38-5) is a chemical compound with the molecular formula C9H16FNO3 and a molecular weight of 205.23 g/mol. IUPAC name: tert-butyl 3-(fluoromethyl)-3-hydroxyazetidine-1-carboxylate. InChIKey: OKGRABVKJDDPDZ-UHFFFAOYSA-N.
| Molecular formula | C9H16FNO3 |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | tert-butyl 3-(fluoromethyl)-3-hydroxyazetidine-1-carboxylate |
| InChIKey | OKGRABVKJDDPDZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(CF)O |
Computed by PubChem (NCBI)