cas: 1798843-08-9 — see every product listed under this CAS number, including other names
tert-butyl 3-(tetramethyl-1,3,2-dioxaborolan-2-yl)-4H,5H,6H,7H-pyrazolo[1,5-a]pyrazine-5-carboxylate, 97% (CAS 1798843-08-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JUF2-100mg |
| cas | 1798843-08-9 |
| size | 100mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 500mg | 246.80 Pln | |
| Chemat | 1g | 347.60 Pln | |
| Chemat | 5g | 851.60 Pln | |
| Chemat | 10g | 1590.80 Pln | |
| Chemat | 25g | 3251.60 Pln | |
| Chemat | 250g | 7806.80 Pln | |
| Chemat | 500g | 15259.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate (CAS 1798843-08-9) is a chemical compound with the molecular formula C17H28BN3O4 and a molecular weight of 349.2 g/mol. IUPAC name: tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate. InChIKey: LALHIGTULYBLSQ-UHFFFAOYSA-N.
| Molecular formula | C17H28BN3O4 |
|---|---|
| Molecular weight | 349.2 g/mol |
| IUPAC name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
| InChIKey | LALHIGTULYBLSQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3CN(CCN3N=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)