cas: 1801243-43-5 — see every product listed under this CAS number, including other names
tert-butyl 3-[(3,5-dimethoxyphenyl)methylene]azetidine-1-carboxylate, 97% (CAS 1801243-43-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch135TKR-250mg |
| cas | 1801243-43-5 |
| size | 250mg |
| availability | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 674.00 Pln | |
| Chemat | 500mg | 1072.40 Pln | |
| Chemat | 1g | 1595.60 Pln | |
| Chemat | 5g | 4811.60 Pln | |
| Chemat | 10g | 8133.20 Pln | |
| Fluorochem | 250mg | 1242.29 Pln | |
| Fluorochem | 500mg | 1981.61 Pln | |
| Fluorochem | 1g | 2965.64 Pln | |
| Fluorochem | 5g | 8765.68 Pln | |
| Fluorochem | 10g | 14846.87 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[(3,5-dimethoxyphenyl)methylidene]azetidine-1-carboxylate (CAS 1801243-43-5) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: tert-butyl 3-[(3,5-dimethoxyphenyl)methylidene]azetidine-1-carboxylate. InChIKey: MFXOKRIDZSDTII-UHFFFAOYSA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | tert-butyl 3-[(3,5-dimethoxyphenyl)methylidene]azetidine-1-carboxylate |
| InChIKey | MFXOKRIDZSDTII-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=CC2=CC(=CC(=C2)OC)OC)C1 |
Computed by PubChem (NCBI)