cas: 1624261-43-3 — see every product listed under this CAS number, including other names
tert-butyl 4,4-dibromopiperidine-1-carboxylate, 95%, 95% (CAS 1624261-43-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112T5R-100mg |
| cas | 1624261-43-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 640.40 Pln | |
| Chemat | 250mg | 1509.20 Pln | |
| Chemat | 1g | 2968.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4,4-dibromopiperidine-1-carboxylate (CAS 1624261-43-3) is a chemical compound with the molecular formula C10H17Br2NO2 and a molecular weight of 343.06 g/mol. IUPAC name: tert-butyl 4,4-dibromopiperidine-1-carboxylate. InChIKey: IBTAYOVUDZSXKE-UHFFFAOYSA-N.
| Molecular formula | C10H17Br2NO2 |
|---|---|
| Molecular weight | 343.06 g/mol |
| IUPAC name | tert-butyl 4,4-dibromopiperidine-1-carboxylate |
| InChIKey | IBTAYOVUDZSXKE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(Br)Br |
Computed by PubChem (NCBI)