cas: 877401-26-8 — see every product listed under this CAS number, including other names
tert-butyl 4-[(4-bromo-1H-pyrazol-1-yl)methyl]piperidine-1-carboxylate, 97% (CAS 877401-26-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F519364-1G |
| cas | 877401-26-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1596.33 Pln | |
| Fluorochem | 100mg | 534.20 Pln | |
| Fluorochem | 250mg | 685.19 Pln | |
| Fluorochem | 500mg | 1091.30 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-[(4-bromopyrazol-1-yl)methyl]piperidine-1-carboxylate (CAS 877401-26-8) is a chemical compound with the molecular formula C14H22BrN3O2 and a molecular weight of 344.25 g/mol. IUPAC name: tert-butyl 4-[(4-bromopyrazol-1-yl)methyl]piperidine-1-carboxylate. InChIKey: CPQOXXUFBKSPFB-UHFFFAOYSA-N.
| Molecular formula | C14H22BrN3O2 |
|---|---|
| Molecular weight | 344.25 g/mol |
| IUPAC name | tert-butyl 4-[(4-bromopyrazol-1-yl)methyl]piperidine-1-carboxylate |
| InChIKey | CPQOXXUFBKSPFB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CN2C=C(C=N2)Br |
Computed by PubChem (NCBI)