cas: 896103-62-1 — see every product listed under this CAS number, including other names
tert-butyl 4-[2-(methylamino)ethyl]piperidine-1-carboxylate, 95%, 95% (CAS 896103-62-1) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H5F1-25mg |
| cas | 896103-62-1 |
| size | 25mg |
| availability | 12.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 136.40 Pln | |
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 952.40 Pln | |
| Chemat | 5g | 2747.60 Pln | |
| Chemat | 10g | 4624.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-[2-(methylamino)ethyl]piperidine-1-carboxylate (CAS 896103-62-1) is a chemical compound with the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. IUPAC name: tert-butyl 4-[2-(methylamino)ethyl]piperidine-1-carboxylate. InChIKey: PAWONGOVVNXTDP-UHFFFAOYSA-N.
| Molecular formula | C13H26N2O2 |
|---|---|
| Molecular weight | 242.36 g/mol |
| IUPAC name | tert-butyl 4-[2-(methylamino)ethyl]piperidine-1-carboxylate |
| InChIKey | PAWONGOVVNXTDP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CCNC |
Computed by PubChem (NCBI)