cas: 873924-08-4 — see every product listed under this CAS number, including other names
tert-butyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate 97% (CAS 873924-08-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A180994-100mg |
| cas | 873924-08-4 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 587.31 Pln | |
| Ambeed | 10g | 1060.12 Pln | |
| Ambeed | 25g | 2473.00 Pln | |
| Ambeed | 100g | 6561.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A180994 |
Tert-butyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate (CAS 873924-08-4) is a chemical compound with the molecular formula C15H25NO3 and a molecular weight of 267.36 g/mol. IUPAC name: tert-butyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate. InChIKey: UXZBTEIHIQFMIT-UHFFFAOYSA-N.
| Molecular formula | C15H25NO3 |
|---|---|
| Molecular weight | 267.36 g/mol |
| IUPAC name | tert-butyl 9-oxo-3-azaspiro[5.5]undecane-3-carboxylate |
| InChIKey | UXZBTEIHIQFMIT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(=O)CC2)CC1 |
Computed by PubChem (NCBI)