cas: 1630906-49-8 — see every product listed under this CAS number, including other names
tert-butyl N-({3-aminobicyclo[1.1.1]pentan-1-yl}methyl)carbamate 98% (CAS 1630906-49-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A282410-25mg |
| cas | 1630906-49-8 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 871.00 Pln | |
| Ambeed | 50mg | 1249.25 Pln | |
| Ambeed | 100mg | 1577.44 Pln | |
| Ambeed | 250mg | 2806.75 Pln | |
| Ambeed | 1g | 6294.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A282410 |
Tert-butyl N-[(3-amino-1-bicyclo[1.1.1]pentanyl)methyl]carbamate (CAS 1630906-49-8) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl N-[(3-amino-1-bicyclo[1.1.1]pentanyl)methyl]carbamate. InChIKey: TXIPPSCTYAERAQ-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl N-[(3-amino-1-bicyclo[1.1.1]pentanyl)methyl]carbamate |
| InChIKey | TXIPPSCTYAERAQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC12CC(C1)(C2)N |
Computed by PubChem (NCBI)