cas: 1400668-06-5 — see every product listed under this CAS number, including other names
tert-butyl N-[(tert-butoxy)carbonyl]-N-[6-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazin-2-yl]carbamate, >95%, >95% (CAS 1400668-06-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EL3S-50mg |
| cas | 1400668-06-5 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 2872.40 Pln | |
| Chemat | 100mg | 3578.00 Pln | |
| Chemat | 250mg | 5301.20 Pln | |
| Chemat | 1g | 12462.80 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazin-2-yl]carbamate (CAS 1400668-06-5) is a chemical compound with the molecular formula C20H32BN3O6 and a molecular weight of 421.3 g/mol. IUPAC name: tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazin-2-yl]carbamate. InChIKey: MPDGREDXDDKJJG-UHFFFAOYSA-N.
| Molecular formula | C20H32BN3O6 |
|---|---|
| Molecular weight | 421.3 g/mol |
| IUPAC name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazin-2-yl]carbamate |
| InChIKey | MPDGREDXDDKJJG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=CC(=N2)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)