cas: 126402-64-0 — see every product listed under this CAS number, including other names
tert-butyl N-[2-(benzylazaniumyl)ethyl]carbamate chloride (CAS 126402-64-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F402237-250MG |
| cas | 126402-64-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 674.78 Pln | |
| Fluorochem | 1g | 820.56 Pln |
| delivery time | 2-3 weeks |
|---|
Tert-butyl N-[2-(benzylamino)ethyl]carbamate;hydrochloride (CAS 126402-64-0) is a chemical compound with the molecular formula C14H23ClN2O2 and a molecular weight of 286.80 g/mol. IUPAC name: tert-butyl N-[2-(benzylamino)ethyl]carbamate;hydrochloride. InChIKey: BQSIYDULWOXMLG-UHFFFAOYSA-N.
| Molecular formula | C14H23ClN2O2 |
|---|---|
| Molecular weight | 286.80 g/mol |
| IUPAC name | tert-butyl N-[2-(benzylamino)ethyl]carbamate;hydrochloride |
| InChIKey | BQSIYDULWOXMLG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCNCC1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)