cas: 1417551-40-6 — see every product listed under this CAS number, including other names
tert-butyl N-{4-ethynylbicyclo[2.2.2]octan-1-yl}carbamate, 97%, 97% (CAS 1417551-40-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11M2XI-100mg |
| cas | 1417551-40-6 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 602.00 Pln | |
| Chemat | 250mg | 933.20 Pln | |
| Chemat | 500mg | 1509.20 Pln | |
| Chemat | 1g | 2238.80 Pln | |
| Chemat | 5g | 8138.00 Pln | |
| Chemat | 10g | 13523.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(4-ethynyl-1-bicyclo[2.2.2]octanyl)carbamate (CAS 1417551-40-6) is a chemical compound with the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. IUPAC name: tert-butyl N-(4-ethynyl-1-bicyclo[2.2.2]octanyl)carbamate. InChIKey: MRDQUTGLADPWES-UHFFFAOYSA-N.
| Molecular formula | C15H23NO2 |
|---|---|
| Molecular weight | 249.35 g/mol |
| IUPAC name | tert-butyl N-(4-ethynyl-1-bicyclo[2.2.2]octanyl)carbamate |
| InChIKey | MRDQUTGLADPWES-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CCC(CC1)(CC2)C#C |
Computed by PubChem (NCBI)