cas: 82755-59-7 — see every product listed under this CAS number, including other names
trans,trans-4-((4-(Aminomethyl)cyclohexane-1-carboxamido)methyl)cyclohexane-1-carboxylic acid 98% (CAS 82755-59-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1536903-50mg |
| cas | 82755-59-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 871.00 Pln | |
| Ambeed | 100mg | 1521.81 Pln | |
| Ambeed | 250mg | 3401.94 Pln | |
| Ambeed | 1g | 8063.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1536903 |
4-[[[4-(aminomethyl)cyclohexanecarbonyl]amino]methyl]cyclohexane-1-carboxylic acid (CAS 82755-59-7) is a chemical compound with the molecular formula C16H28N2O3 and a molecular weight of 296.40 g/mol. IUPAC name: 4-[[[4-(aminomethyl)cyclohexanecarbonyl]amino]methyl]cyclohexane-1-carboxylic acid. InChIKey: DPRKOLIXLGICGL-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O3 |
|---|---|
| Molecular weight | 296.40 g/mol |
| IUPAC name | 4-[[[4-(aminomethyl)cyclohexanecarbonyl]amino]methyl]cyclohexane-1-carboxylic acid |
| InChIKey | DPRKOLIXLGICGL-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1CN)C(=O)NCC2CCC(CC2)C(=O)O |
Computed by PubChem (NCBI)