cas: 301226-53-9 — see every product listed under this CAS number, including other names
trans-1-(tert-Butoxycarbonyl)-4-(3-fluorophenyl)pyrrolidine-3-carboxylic acid, 98% (CAS 301226-53-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F325102-100MG |
| cas | 301226-53-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 424.87 Pln | |
| Fluorochem | 250mg | 690.40 Pln | |
| Fluorochem | 1g | 1632.78 Pln | |
| Fluorochem | 5g | 6313.42 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3R,4S)-4-(3-fluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 301226-53-9) is a chemical compound with the molecular formula C16H20FNO4 and a molecular weight of 309.33 g/mol. IUPAC name: (3R,4S)-4-(3-fluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: NUVNFNVJYJQLRA-OLZOCXBDSA-N.
| Molecular formula | C16H20FNO4 |
|---|---|
| Molecular weight | 309.33 g/mol |
| IUPAC name | (3R,4S)-4-(3-fluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | NUVNFNVJYJQLRA-OLZOCXBDSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)C(=O)O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)