cas: 15942-08-2 — see every product listed under this CAS number, including other names
trans-4-(6,8-dibromo-1,2-dihydroquinazolin-3(4H)-yl)cyclohexanol hydrochloride, 95%, 95% (CAS 15942-08-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112QP6-250mg |
| cas | 15942-08-2 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 760.40 Pln | |
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 1g | 1811.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(6,8-dibromo-2,4-dihydro-1H-quinazolin-3-yl)cyclohexan-1-ol;hydrochloride (CAS 15942-08-2) is a chemical compound with the molecular formula C14H19Br2ClN2O and a molecular weight of 426.57 g/mol. IUPAC name: 4-(6,8-dibromo-2,4-dihydro-1H-quinazolin-3-yl)cyclohexan-1-ol;hydrochloride. InChIKey: ICLHRFYBPXBCPE-UHFFFAOYSA-N.
| Molecular formula | C14H19Br2ClN2O |
|---|---|
| Molecular weight | 426.57 g/mol |
| IUPAC name | 4-(6,8-dibromo-2,4-dihydro-1H-quinazolin-3-yl)cyclohexan-1-ol;hydrochloride |
| InChIKey | ICLHRFYBPXBCPE-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1N2CC3=C(C(=CC(=C3)Br)Br)NC2)O.Cl |
Computed by PubChem (NCBI)