cas: 166168-16-7 — see every product listed under this CAS number, including other names
trans-4-(Boc-aminomethyl)cyclohexanemethanamine, 95%, 95% (CAS 166168-16-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 250g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112WIG-250mg |
| cas | 166168-16-7 |
| size | 250mg |
| availability | 250g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 438.80 Pln | |
| Chemat | 5g | 1302.80 Pln | |
| Chemat | 10g | 2267.60 Pln | |
| Chemat | 25g | 4542.80 Pln | |
| Chemat | 250g | 29589.20 Pln | |
| Chemat | 50g | 7437.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[[4-(aminomethyl)cyclohexyl]methyl]carbamate (CAS 166168-16-7) is a chemical compound with the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. IUPAC name: tert-butyl N-[[4-(aminomethyl)cyclohexyl]methyl]carbamate. InChIKey: NYXOBVVHJZENCO-UHFFFAOYSA-N.
| Molecular formula | C13H26N2O2 |
|---|---|
| Molecular weight | 242.36 g/mol |
| IUPAC name | tert-butyl N-[[4-(aminomethyl)cyclohexyl]methyl]carbamate |
| InChIKey | NYXOBVVHJZENCO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CCC(CC1)CN |
Computed by PubChem (NCBI)