trans-8-amino-7-fluoro-2-aza-spiro[4.4]nonane-2-carboxylic acid tert-butyl ester, 95%
cas: 1638757-74-0 — see every product listed under this CAS number, including other names
trans-8-amino-7-fluoro-2-aza-spiro[4.4]nonane-2-carboxylic acid tert-butyl ester, 95% (CAS 1638757-74-0) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A736947-10mg |
| cas | 1638757-74-0 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 565.06 Pln | |
| Ambeed | 25mg | 1010.06 Pln | |
| Ambeed | 50mg | 1666.44 Pln | |
| Ambeed | 100mg | 2790.06 Pln | |
| Ambeed | 250mg | 4709.12 Pln | |
| Ambeed | 1g | 11662.25 Pln | |
| BLDpharm | 10mg | 608.70 Pln | |
| BLDpharm | 25mg | 1086.31 Pln | |
| BLDpharm | 50mg | 1791.62 Pln | |
| BLDpharm | 100mg | 3002.30 Pln | |
| BLDpharm | 250mg | 5073.79 Pln | |
| BLDpharm | 1g | 12571.15 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl (7S,8S)-7-amino-8-fluoro-2-azaspiro[4.4]nonane-2-carboxylate (CAS 1638757-74-0) is a chemical compound with the molecular formula C13H23FN2O2 and a molecular weight of 258.33 g/mol. IUPAC name: tert-butyl (7S,8S)-7-amino-8-fluoro-2-azaspiro[4.4]nonane-2-carboxylate. InChIKey: RMLUGCZJYTXPOU-UCBNGSGESA-N.
| Molecular formula | C13H23FN2O2 |
|---|---|
| Molecular weight | 258.33 g/mol |
| IUPAC name | tert-butyl (7S,8S)-7-amino-8-fluoro-2-azaspiro[4.4]nonane-2-carboxylate |
| InChIKey | RMLUGCZJYTXPOU-UCBNGSGESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)C[C@@H]([C@H](C2)F)N |
Computed by PubChem (NCBI)