cas: 1232059-97-0 — see every product listed under this CAS number, including other names
trans-tert-Butyl 4-amino-3-methoxypiperidine-1-carboxylate, 95+% (CAS 1232059-97-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A505091-1g |
| cas | 1232059-97-0 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 7087.78 Pln | |
| AmBeed | 10g | 18350.08 Pln | |
| AmBeed | 5g | 11416.93 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl (3R,4R)-4-amino-3-methoxypiperidine-1-carboxylate (CAS 1232059-97-0) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl (3R,4R)-4-amino-3-methoxypiperidine-1-carboxylate. InChIKey: QNGHCFVWYKWWMU-RKDXNWHRSA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl (3R,4R)-4-amino-3-methoxypiperidine-1-carboxylate |
| InChIKey | QNGHCFVWYKWWMU-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@@H](C1)OC)N |
Computed by PubChem (NCBI)