cas: 31683-47-3 — see every product listed under this CAS number, including other names
trimethyl(3-phenylprop-1-yn-1-yl)silane, 95%, 95% (CAS 31683-47-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMPC-100mg |
| cas | 31683-47-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1442.00 Pln | |
| Chemat | 250mg | 2128.40 Pln | |
| Chemat | 500mg | 3165.20 Pln | |
| Chemat | 1g | 4197.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Trimethyl(3-phenylprop-1-ynyl)silane (CAS 31683-47-3) is a chemical compound with the molecular formula C12H16Si and a molecular weight of 188.34 g/mol. IUPAC name: trimethyl(3-phenylprop-1-ynyl)silane. InChIKey: KSFXECUKKKCCEN-UHFFFAOYSA-N.
| Molecular formula | C12H16Si |
|---|---|
| Molecular weight | 188.34 g/mol |
| IUPAC name | trimethyl(3-phenylprop-1-ynyl)silane |
| InChIKey | KSFXECUKKKCCEN-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CCC1=CC=CC=C1 |
Computed by PubChem (NCBI)